C18H19F6N3O4 — CID 152567201
1,1,1,3,3,3-hexafluoropropan-2-yl 4-(3,4-dihydro-2H-1,4-benzoxazine-2-carbonylamino)piperidine-1-carboxylate (PubChem CID 152567201) has the molecular formula C18H19F6N3O4 and a molecular weight of 455.36 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(3,4-dihydro-2H-1,4-benzoxazine-2-carbonylamino)piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(3,4-dihydro-2H-1,4-benzoxazine-2-carbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 152567201 |
| Molecular Formula | C18H19F6N3O4 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(3,4-dihydro-2H-1,4-benzoxazine-2-carbonylamino)piperidine-1-carboxylate |
| SMILES | O=C(NC1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1)C1CNc2ccccc2O1 |
| InChI | InChI=1S/C18H19F6N3O4/c19-17(20,21)15(18(22,23)24)31-16(29)27-7-5-10(6-8-27)26-14(28)13-9-25-11-3-1-2-4-12(11)30-13/h1-4,10,13,15,25H,5-9H2,(H,26,28) |
| InChIKey | YQSLVTSXLZJHMZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |