C11H20N2O — CID 130485538
cyclopropyl-(2-ethyl-1,4-oxazepan-4-yl)methanimine (PubChem CID 130485538) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is cyclopropyl-(2-ethyl-1,4-oxazepan-4-yl)methanimine.
| Compound Name | cyclopropyl-(2-ethyl-1,4-oxazepan-4-yl)methanimine |
|---|---|
| PubChem CID | 130485538 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | cyclopropyl-(2-ethyl-1,4-oxazepan-4-yl)methanimine |
| SMILES | [H]/N=C(\C1CC1)N1CCCOC(CC)C1 |
| InChI | InChI=1S/C11H20N2O/c1-2-10-8-13(6-3-7-14-10)11(12)9-4-5-9/h9-10,12H,2-8H2,1H3/b12-11+ |
| InChIKey | CEQPRHQRNAWHNF-VAWYXSNFSA-N |
| XLogP | 1.87 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|