C16H25N5O4 — CID 13059619
N-(diaminomethylidene)morpholine-4-carboximidamide;2-methyl-2-phenoxypropanoic acid (PubChem CID 13059619) has the molecular formula C16H25N5O4 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(diaminomethylidene)morpholine-4-carboximidamide;2-methyl-2-phenoxypropanoic acid.
| Compound Name | N-(diaminomethylidene)morpholine-4-carboximidamide;2-methyl-2-phenoxypropanoic acid |
|---|---|
| PubChem CID | 13059619 |
| Molecular Formula | C16H25N5O4 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-(diaminomethylidene)morpholine-4-carboximidamide;2-methyl-2-phenoxypropanoic acid |
| SMILES | CC(C)(Oc1ccccc1)C(=O)O.[H]/N=C(\N=C(N)N)N1CCOCC1 |
| InChI | InChI=1S/C10H12O3.C6H13N5O/c1-10(2,9(11)12)13-8-6-4-3-5-7-8;7-5(8)10-6(9)11-1-3-12-4-2-11/h3-7H,1-2H3,(H,11,12);1-4H2,(H5,7,8,9,10) |
| InChIKey | QJJFKXVDSOPXHV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 147.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|