C7H12BrNO2 — CID 63679551
2-bromo-1-(1,4-oxazepan-4-yl)ethanone (PubChem CID 63679551) has the molecular formula C7H12BrNO2 and a molecular weight of 222.08 g/mol. Its IUPAC name is 2-bromo-1-(1,4-oxazepan-4-yl)ethanone.
| Compound Name | 2-bromo-1-(1,4-oxazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 63679551 |
| Molecular Formula | C7H12BrNO2 |
| Molecular Weight | 222.08 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 2-bromo-1-(1,4-oxazepan-4-yl)ethanone |
| SMILES | O=C(CBr)N1CCCOCC1 |
| InChI | InChI=1S/C7H12BrNO2/c8-6-7(10)9-2-1-4-11-5-3-9/h1-6H2 |
| InChIKey | KPPVPLBBVDZKLP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.08 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|