C9H13NO2 — CID 126990282
1-(1,4-oxazepan-4-yl)but-2-yn-1-one (PubChem CID 126990282) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-(1,4-oxazepan-4-yl)but-2-yn-1-one.
| Compound Name | 1-(1,4-oxazepan-4-yl)but-2-yn-1-one |
|---|---|
| PubChem CID | 126990282 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1-(1,4-oxazepan-4-yl)but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCCOCC1 |
| InChI | InChI=1S/C9H13NO2/c1-2-4-9(11)10-5-3-7-12-8-6-10/h3,5-8H2,1H3 |
| InChIKey | QVHGYWRZAQEART-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|