About CID 136747595
CID 136747595 (PubChem CID 136747595) has the molecular formula C5H8BNO2
and a molecular weight of 124.94 g/mol.
Molecular Properties
| Compound Name | CID 136747595 |
| PubChem CID | 136747595 |
| Molecular Formula | C5H8BNO2 |
| Molecular Weight | 124.94 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCOCC1 |
| InChI | InChI=1S/C5H8BNO2/c6-5(8)7-1-3-9-4-2-7/h1-4H2 |
| InChIKey | BWKAWXGPBDAGNK-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.94 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136747595 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136747595?
The IUPAC name of CID 136747595 (CID 136747595) is not available.
What is the SMILES notation for CID 136747595?
The canonical SMILES for CID 136747595 is [B]C(=O)N1CCOCC1.
What is the InChIKey of CID 136747595?
The InChIKey is BWKAWXGPBDAGNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BNO2/c6-5(8)7-1-3-9-4-2-7/h1-4H2.
What are the key properties of CID 136747595?
CID 136747595 has a molecular weight of 124.94 g/mol, XLogP of -0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136747595 is sourced from PubChem (CID 136747595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).