C8H17N3O4 — CID 69170925
2-(methylamino)acetic acid;morpholine-4-carboxamide (PubChem CID 69170925) has the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-(methylamino)acetic acid;morpholine-4-carboxamide.
| Compound Name | 2-(methylamino)acetic acid;morpholine-4-carboxamide |
|---|---|
| PubChem CID | 69170925 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-(methylamino)acetic acid;morpholine-4-carboxamide |
| SMILES | CNCC(=O)O.NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C5H10N2O2.C3H7NO2/c6-5(8)7-1-3-9-4-2-7;1-4-2-3(5)6/h1-4H2,(H2,6,8);4H,2H2,1H3,(H,5,6) |
| InChIKey | FMYYQTOHPQUCAZ-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |