C8H15N3O3 — CID 131223612
2-(6-methyl-1,4-oxazepan-4-yl)-2-oxoacetohydrazide (PubChem CID 131223612) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-(6-methyl-1,4-oxazepan-4-yl)-2-oxoacetohydrazide.
| Compound Name | 2-(6-methyl-1,4-oxazepan-4-yl)-2-oxoacetohydrazide |
|---|---|
| PubChem CID | 131223612 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 2-(6-methyl-1,4-oxazepan-4-yl)-2-oxoacetohydrazide |
| SMILES | CC1COCCN(C(=O)C(=O)NN)C1 |
| InChI | InChI=1S/C8H15N3O3/c1-6-4-11(2-3-14-5-6)8(13)7(12)10-9/h6H,2-5,9H2,1H3,(H,10,12) |
| InChIKey | RAAHQMCNBPQFRP-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|