C8H17N3O2 — CID 63573861
2-(3-methylmorpholin-4-yl)propanehydrazide (PubChem CID 63573861) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(3-methylmorpholin-4-yl)propanehydrazide.
| Compound Name | 2-(3-methylmorpholin-4-yl)propanehydrazide |
|---|---|
| PubChem CID | 63573861 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 2-(3-methylmorpholin-4-yl)propanehydrazide |
| SMILES | CC1COCCN1C(C)C(=O)NN |
| InChI | InChI=1S/C8H17N3O2/c1-6-5-13-4-3-11(6)7(2)8(12)10-9/h6-7H,3-5,9H2,1-2H3,(H,10,12) |
| InChIKey | KXFHLXYBZIOGSR-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|