C9H18N4O3 — CID 83105404
4-(1-hydrazinyl-1-oxopropan-2-yl)-N-methylmorpholine-3-carboxamide (PubChem CID 83105404) has the molecular formula C9H18N4O3 and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-(1-hydrazinyl-1-oxopropan-2-yl)-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-(1-hydrazinyl-1-oxopropan-2-yl)-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83105404 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 4-(1-hydrazinyl-1-oxopropan-2-yl)-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1C(C)C(=O)NN |
| InChI | InChI=1S/C9H18N4O3/c1-6(8(14)12-10)13-3-4-16-5-7(13)9(15)11-2/h6-7H,3-5,10H2,1-2H3,(H,11,15)(H,12,14) |
| InChIKey | PHDRDMSXVKLXOO-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|