C8H17N3O3 — CID 131000958
2-(6-hydroxy-1,4-oxazepan-4-yl)propanehydrazide (PubChem CID 131000958) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-(6-hydroxy-1,4-oxazepan-4-yl)propanehydrazide.
| Compound Name | 2-(6-hydroxy-1,4-oxazepan-4-yl)propanehydrazide |
|---|---|
| PubChem CID | 131000958 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-(6-hydroxy-1,4-oxazepan-4-yl)propanehydrazide |
| SMILES | CC(C(=O)NN)N1CCOCC(O)C1 |
| InChI | InChI=1S/C8H17N3O3/c1-6(8(13)10-9)11-2-3-14-5-7(12)4-11/h6-7,12H,2-5,9H2,1H3,(H,10,13) |
| InChIKey | YQUQBVQLAOGULD-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|