C9H19N3O2 — CID 102968624
2-(3-hydroxy-4-methylpiperidin-1-yl)propanehydrazide (PubChem CID 102968624) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(3-hydroxy-4-methylpiperidin-1-yl)propanehydrazide.
| Compound Name | 2-(3-hydroxy-4-methylpiperidin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 102968624 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-(3-hydroxy-4-methylpiperidin-1-yl)propanehydrazide |
| SMILES | CC1CCN(C(C)C(=O)NN)CC1O |
| InChI | InChI=1S/C9H19N3O2/c1-6-3-4-12(5-8(6)13)7(2)9(14)11-10/h6-8,13H,3-5,10H2,1-2H3,(H,11,14) |
| InChIKey | QTZBNMYRIMJGES-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|