C8H14N4O2 — CID 79680453
2-(2-cyanomorpholin-4-yl)propanehydrazide (PubChem CID 79680453) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-(2-cyanomorpholin-4-yl)propanehydrazide.
| Compound Name | 2-(2-cyanomorpholin-4-yl)propanehydrazide |
|---|---|
| PubChem CID | 79680453 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-(2-cyanomorpholin-4-yl)propanehydrazide |
| SMILES | CC(C(=O)NN)N1CCOC(C#N)C1 |
| InChI | InChI=1S/C8H14N4O2/c1-6(8(13)11-10)12-2-3-14-7(4-9)5-12/h6-7H,2-3,5,10H2,1H3,(H,11,13) |
| InChIKey | YGMDGMWCCUMBHW-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|