C13H13BrF3NO3 — CID 172647360
[4-bromo-2-(trifluoromethoxy)phenyl]-[(2R)-2-methylmorpholin-4-yl]methanone (PubChem CID 172647360) has the molecular formula C13H13BrF3NO3 and a molecular weight of 368.15 g/mol. Its IUPAC name is [4-bromo-2-(trifluoromethoxy)phenyl]-[(2R)-2-methylmorpholin-4-yl]methanone.
| Compound Name | [4-bromo-2-(trifluoromethoxy)phenyl]-[(2R)-2-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 172647360 |
| Molecular Formula | C13H13BrF3NO3 |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | [4-bromo-2-(trifluoromethoxy)phenyl]-[(2R)-2-methylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(Br)cc2OC(F)(F)F)CCO1 |
| InChI | InChI=1S/C13H13BrF3NO3/c1-8-7-18(4-5-20-8)12(19)10-3-2-9(14)6-11(10)21-13(15,16)17/h2-3,6,8H,4-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | SQYVHWWIXINFTQ-MRVPVSSYSA-N |
| XLogP | 3.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |