C14H15BrN2O2 — CID 172654877
(6-bromo-1H-indol-3-yl)-(2-methylmorpholin-4-yl)methanone (PubChem CID 172654877) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is (6-bromo-1H-indol-3-yl)-(2-methylmorpholin-4-yl)methanone.
| Compound Name | (6-bromo-1H-indol-3-yl)-(2-methylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 172654877 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | (6-bromo-1H-indol-3-yl)-(2-methylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2c[nH]c3cc(Br)ccc23)CCO1 |
| InChI | InChI=1S/C14H15BrN2O2/c1-9-8-17(4-5-19-9)14(18)12-7-16-13-6-10(15)2-3-11(12)13/h2-3,6-7,9,16H,4-5,8H2,1H3 |
| InChIKey | GVEZZRCYDLXYSL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |