C13H13BrF3NO3 — CID 103925345
[4-bromo-2-(trifluoromethyl)phenyl]-[2-(hydroxymethyl)morpholin-4-yl]methanone (PubChem CID 103925345) has the molecular formula C13H13BrF3NO3 and a molecular weight of 368.15 g/mol. Its IUPAC name is [4-bromo-2-(trifluoromethyl)phenyl]-[2-(hydroxymethyl)morpholin-4-yl]methanone.
| Compound Name | [4-bromo-2-(trifluoromethyl)phenyl]-[2-(hydroxymethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 103925345 |
| Molecular Formula | C13H13BrF3NO3 |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | [4-bromo-2-(trifluoromethyl)phenyl]-[2-(hydroxymethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1ccc(Br)cc1C(F)(F)F)N1CCOC(CO)C1 |
| InChI | InChI=1S/C13H13BrF3NO3/c14-8-1-2-10(11(5-8)13(15,16)17)12(20)18-3-4-21-9(6-18)7-19/h1-2,5,9,19H,3-4,6-7H2 |
| InChIKey | FBGLKMHTDJUFDI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |