About azane;(2-methylmorpholin-4-yl) propanoate
azane;(2-methylmorpholin-4-yl) propanoate (PubChem CID 174846679) has the molecular formula C8H18N2O3
and a molecular weight of 190.24 g/mol. Its IUPAC name is azane;(2-methylmorpholin-4-yl) propanoate.
Molecular Properties
| Compound Name | azane;(2-methylmorpholin-4-yl) propanoate |
| PubChem CID | 174846679 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | azane;(2-methylmorpholin-4-yl) propanoate |
| SMILES | CCC(=O)ON1CCOC(C)C1.N |
| InChI | InChI=1S/C8H15NO3.H3N/c1-3-8(10)12-9-4-5-11-7(2)6-9;/h7H,3-6H2,1-2H3;1H3 |
| InChIKey | UQGOWBLLQDFOIM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 73.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;(2-methylmorpholin-4-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(2-methylmorpholin-4-yl) propanoate?
The IUPAC name of azane;(2-methylmorpholin-4-yl) propanoate (CID 174846679) is azane;(2-methylmorpholin-4-yl) propanoate.
What is the SMILES notation for azane;(2-methylmorpholin-4-yl) propanoate?
The canonical SMILES for azane;(2-methylmorpholin-4-yl) propanoate is CCC(=O)ON1CCOC(C)C1.N.
What is the InChIKey of azane;(2-methylmorpholin-4-yl) propanoate?
The InChIKey is UQGOWBLLQDFOIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3.H3N/c1-3-8(10)12-9-4-5-11-7(2)6-9;/h7H,3-6H2,1-2H3;1H3.
What are the key properties of azane;(2-methylmorpholin-4-yl) propanoate?
azane;(2-methylmorpholin-4-yl) propanoate has a molecular weight of 190.24 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(2-methylmorpholin-4-yl) propanoate is sourced from PubChem (CID 174846679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).