C20H34O — CID 11312339
(6R,10R)-2,6,10,14-tetramethyl-7-methylidenepentadeca-2,13-dien-8-one (PubChem CID 11312339) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (6R,10R)-2,6,10,14-tetramethyl-7-methylidenepentadeca-2,13-dien-8-one.
| Compound Name | (6R,10R)-2,6,10,14-tetramethyl-7-methylidenepentadeca-2,13-dien-8-one |
|---|---|
| PubChem CID | 11312339 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (6R,10R)-2,6,10,14-tetramethyl-7-methylidenepentadeca-2,13-dien-8-one |
| SMILES | C=C(C(=O)C[C@H](C)CCC=C(C)C)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C20H34O/c1-15(2)10-8-12-17(5)14-20(21)19(7)18(6)13-9-11-16(3)4/h10-11,17-18H,7-9,12-14H2,1-6H3/t17-,18-/m1/s1 |
| InChIKey | WWFOGCOHPOACCX-QZTJIDSGSA-N |
| XLogP | 6.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|