C18H34O2 — CID 138976111
(3S,7R,9S)-2,9,13-trimethyl-5-methylidenetetradec-12-ene-3,7-diol (PubChem CID 138976111) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is (3S,7R,9S)-2,9,13-trimethyl-5-methylidenetetradec-12-ene-3,7-diol.
| Compound Name | (3S,7R,9S)-2,9,13-trimethyl-5-methylidenetetradec-12-ene-3,7-diol |
|---|---|
| PubChem CID | 138976111 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | (3S,7R,9S)-2,9,13-trimethyl-5-methylidenetetradec-12-ene-3,7-diol |
| SMILES | C=C(C[C@H](O)C[C@@H](C)CCC=C(C)C)C[C@H](O)C(C)C |
| InChI | InChI=1S/C18H34O2/c1-13(2)8-7-9-15(5)10-17(19)11-16(6)12-18(20)14(3)4/h8,14-15,17-20H,6-7,9-12H2,1-5H3/t15-,17+,18-/m0/s1 |
| InChIKey | YAJFDUQQFZJHCH-JQHSSLGASA-N |
| XLogP | 4.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|