C17H31NO — CID 2867109
N,N-bis(6-methylhept-5-en-2-yl)formamide (PubChem CID 2867109) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is N,N-bis(6-methylhept-5-en-2-yl)formamide.
| Compound Name | N,N-bis(6-methylhept-5-en-2-yl)formamide |
|---|---|
| PubChem CID | 2867109 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | N,N-bis(6-methylhept-5-en-2-yl)formamide |
| SMILES | CC(C)=CCCC(C)N(C=O)C(C)CCC=C(C)C |
| InChI | InChI=1S/C17H31NO/c1-14(2)9-7-11-16(5)18(13-19)17(6)12-8-10-15(3)4/h9-10,13,16-17H,7-8,11-12H2,1-6H3 |
| InChIKey | DPLSPVPSCNGGTJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|