C13H27NO — CID 57421709
N,N-bis(4-methylpentan-2-yl)formamide (PubChem CID 57421709) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is N,N-bis(4-methylpentan-2-yl)formamide.
| Compound Name | N,N-bis(4-methylpentan-2-yl)formamide |
|---|---|
| PubChem CID | 57421709 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N,N-bis(4-methylpentan-2-yl)formamide |
| SMILES | CC(C)CC(C)N(C=O)C(C)CC(C)C |
| InChI | InChI=1S/C13H27NO/c1-10(2)7-12(5)14(9-15)13(6)8-11(3)4/h9-13H,7-8H2,1-6H3 |
| InChIKey | POEKLXPQBWOKMV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|