About praseodymium;acetate;trichloride
praseodymium;acetate;trichloride (PubChem CID 175594879) has the molecular formula C2H3Cl3O2Pr-4
and a molecular weight of 306.31 g/mol. Its IUPAC name is praseodymium;acetate;trichloride.
Molecular Properties
| Compound Name | praseodymium;acetate;trichloride |
| PubChem CID | 175594879 |
| Molecular Formula | C2H3Cl3O2Pr-4 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 304.83 |
| IUPAC Name | praseodymium;acetate;trichloride |
| SMILES | CC(=O)[O-].[Cl-].[Cl-].[Cl-].[Pr] |
| InChI | InChI=1S/C2H4O2.3ClH.Pr/c1-2(3)4;;;;/h1H3,(H,3,4);3*1H;/p-4 |
| InChIKey | VPJVTMGYEQUXRL-UHFFFAOYSA-J |
| XLogP | -10.23 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | -10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze praseodymium;acetate;trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of praseodymium;acetate;trichloride?
The IUPAC name of praseodymium;acetate;trichloride (CID 175594879) is praseodymium;acetate;trichloride.
What is the SMILES notation for praseodymium;acetate;trichloride?
The canonical SMILES for praseodymium;acetate;trichloride is CC(=O)[O-].[Cl-].[Cl-].[Cl-].[Pr].
What is the InChIKey of praseodymium;acetate;trichloride?
The InChIKey is VPJVTMGYEQUXRL-UHFFFAOYSA-J. The full InChI is InChI=1S/C2H4O2.3ClH.Pr/c1-2(3)4;;;;/h1H3,(H,3,4);3*1H;/p-4.
What are the key properties of praseodymium;acetate;trichloride?
praseodymium;acetate;trichloride has a molecular weight of 306.31 g/mol, XLogP of -10.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for praseodymium;acetate;trichloride is sourced from PubChem (CID 175594879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).