C14H31N3O2 — CID 170713669
6-amino-2-(propanoylamino)-N-propan-2-ylhexanamide;ethane (PubChem CID 170713669) has the molecular formula C14H31N3O2 and a molecular weight of 273.42 g/mol. Its IUPAC name is 6-amino-2-(propanoylamino)-N-propan-2-ylhexanamide;ethane.
| Compound Name | 6-amino-2-(propanoylamino)-N-propan-2-ylhexanamide;ethane |
|---|---|
| PubChem CID | 170713669 |
| Molecular Formula | C14H31N3O2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.24 |
| IUPAC Name | 6-amino-2-(propanoylamino)-N-propan-2-ylhexanamide;ethane |
| SMILES | CC.CCC(=O)NC(CCCCN)C(=O)NC(C)C |
| InChI | InChI=1S/C12H25N3O2.C2H6/c1-4-11(16)15-10(7-5-6-8-13)12(17)14-9(2)3;1-2/h9-10H,4-8,13H2,1-3H3,(H,14,17)(H,15,16);1-2H3 |
| InChIKey | PHPRBZXDLCBNME-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|