C13H27N3O2 — CID 134583700
N-[(4S)-8-amino-2-methyl-3-oxooctan-4-yl]-2-(ethylamino)acetamide (PubChem CID 134583700) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-[(4S)-8-amino-2-methyl-3-oxooctan-4-yl]-2-(ethylamino)acetamide.
| Compound Name | N-[(4S)-8-amino-2-methyl-3-oxooctan-4-yl]-2-(ethylamino)acetamide |
|---|---|
| PubChem CID | 134583700 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-[(4S)-8-amino-2-methyl-3-oxooctan-4-yl]-2-(ethylamino)acetamide |
| SMILES | CCNCC(=O)N[C@@H](CCCCN)C(=O)C(C)C |
| InChI | InChI=1S/C13H27N3O2/c1-4-15-9-12(17)16-11(7-5-6-8-14)13(18)10(2)3/h10-11,15H,4-9,14H2,1-3H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | RLLIHZQPJYKSCF-NSHDSACASA-N |
| XLogP | 0.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|