C16H30N4O3 — CID 167134006
N-(1-amino-5-methyl-4-oxohexan-3-yl)-2-[(2-piperidin-1-ylacetyl)amino]acetamide (PubChem CID 167134006) has the molecular formula C16H30N4O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-(1-amino-5-methyl-4-oxohexan-3-yl)-2-[(2-piperidin-1-ylacetyl)amino]acetamide.
| Compound Name | N-(1-amino-5-methyl-4-oxohexan-3-yl)-2-[(2-piperidin-1-ylacetyl)amino]acetamide |
|---|---|
| PubChem CID | 167134006 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | N-(1-amino-5-methyl-4-oxohexan-3-yl)-2-[(2-piperidin-1-ylacetyl)amino]acetamide |
| SMILES | CC(C)C(=O)C(CCN)NC(=O)CNC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C16H30N4O3/c1-12(2)16(23)13(6-7-17)19-14(21)10-18-15(22)11-20-8-4-3-5-9-20/h12-13H,3-11,17H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | RROZHLRBNWKXMT-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |