C21H40N4O5 — CID 126693998
N-[2-[[(2S)-1-[[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-2-oxoethyl]octanamide (PubChem CID 126693998) has the molecular formula C21H40N4O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is N-[2-[[(2S)-1-[[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-2-oxoethyl]octanamide.
| Compound Name | N-[2-[[(2S)-1-[[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-2-oxoethyl]octanamide |
|---|---|
| PubChem CID | 126693998 |
| Molecular Formula | C21H40N4O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | N-[2-[[(2S)-1-[[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-2-oxoethyl]octanamide |
| SMILES | CCCCCCCC(=O)NCC(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)C(C)C)C(C)O |
| InChI | InChI=1S/C21H40N4O5/c1-5-6-7-8-9-10-17(27)23-13-18(28)25-19(15(4)26)21(30)24-16(11-12-22)20(29)14(2)3/h14-16,19,26H,5-13,22H2,1-4H3,(H,23,27)(H,24,30)(H,25,28)/t15?,16-,19-/m0/s1 |
| InChIKey | GQYIOGVETUALAK-RRSHCKCTSA-N |
| XLogP | 0.39 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|