C25H48N4O4 — CID 144918102
N-[(2S,3S)-1-[[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-6-octylpiperidine-3-carboxamide (PubChem CID 144918102) has the molecular formula C25H48N4O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is N-[(2S,3S)-1-[[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-6-octylpiperidine-3-carboxamide.
| Compound Name | N-[(2S,3S)-1-[[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-6-octylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 144918102 |
| Molecular Formula | C25H48N4O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.37 |
| IUPAC Name | N-[(2S,3S)-1-[[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-6-octylpiperidine-3-carboxamide |
| SMILES | CCCCCCCCC1CCC(C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)C(C)C)[C@H](C)O)CN1 |
| InChI | InChI=1S/C25H48N4O4/c1-5-6-7-8-9-10-11-20-13-12-19(16-27-20)24(32)29-22(18(4)30)25(33)28-21(14-15-26)23(31)17(2)3/h17-22,27,30H,5-16,26H2,1-4H3,(H,28,33)(H,29,32)/t18-,19?,20?,21-,22-/m0/s1 |
| InChIKey | ZLDYXXMHFVTXEY-CWXRREDCSA-N |
| XLogP | 2.03 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|