C27H50N2O4 — CID 160726425
(2S)-N-[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]-2-[(1S)-1-hydroxyethyl]-4-[(1R,3R)-3-octylcyclohexyl]-4-oxobutanamide (PubChem CID 160726425) has the molecular formula C27H50N2O4 and a molecular weight of 466.71 g/mol. Its IUPAC name is (2S)-N-[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]-2-[(1S)-1-hydroxyethyl]-4-[(1R,3R)-3-octylcyclohexyl]-4-oxobutanamide.
| Compound Name | (2S)-N-[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]-2-[(1S)-1-hydroxyethyl]-4-[(1R,3R)-3-octylcyclohexyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 160726425 |
| Molecular Formula | C27H50N2O4 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | (2S)-N-[(3S)-1-amino-5-methyl-4-oxohexan-3-yl]-2-[(1S)-1-hydroxyethyl]-4-[(1R,3R)-3-octylcyclohexyl]-4-oxobutanamide |
| SMILES | CCCCCCCC[C@@H]1CCC[C@@H](C(=O)C[C@H](C(=O)N[C@@H](CCN)C(=O)C(C)C)[C@H](C)O)C1 |
| InChI | InChI=1S/C27H50N2O4/c1-5-6-7-8-9-10-12-21-13-11-14-22(17-21)25(31)18-23(20(4)30)27(33)29-24(15-16-28)26(32)19(2)3/h19-24,30H,5-18,28H2,1-4H3,(H,29,33)/t20-,21+,22+,23-,24-/m0/s1 |
| InChIKey | RTTUOOZMUINNNV-JTKSJCOOSA-N |
| XLogP | 4.56 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|