C22H43N7O6 — CID 175901918
(2S)-4-amino-2-[[(2S,3R)-2-[[(2S)-5-(diaminomethylideneamino)-2-(octanoylamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]butanoic acid (PubChem CID 175901918) has the molecular formula C22H43N7O6 and a molecular weight of 501.63 g/mol. Its IUPAC name is (2S)-4-amino-2-[[(2S,3R)-2-[[(2S)-5-(diaminomethylideneamino)-2-(octanoylamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]butanoic acid.
| Compound Name | (2S)-4-amino-2-[[(2S,3R)-2-[[(2S)-5-(diaminomethylideneamino)-2-(octanoylamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175901918 |
| Molecular Formula | C22H43N7O6 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.33 |
| IUPAC Name | (2S)-4-amino-2-[[(2S,3R)-2-[[(2S)-5-(diaminomethylideneamino)-2-(octanoylamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]butanoic acid |
| SMILES | CCCCCCCC(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C22H43N7O6/c1-3-4-5-6-7-10-17(31)27-15(9-8-13-26-22(24)25)19(32)29-18(14(2)30)20(33)28-16(11-12-23)21(34)35/h14-16,18,30H,3-13,23H2,1-2H3,(H,27,31)(H,28,33)(H,29,32)(H,34,35)(H4,24,25,26)/t14-,15+,16+,18+/m1/s1 |
| InChIKey | XKOXMEOOVGYSOQ-CVYDXHPNSA-N |
| XLogP | -1.33 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|