C20H38N4O7 — CID 175901864
(2R)-2-[[(2S,3R)-2-[[(2S)-4-amino-2-(nonanoylamino)butanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 175901864) has the molecular formula C20H38N4O7 and a molecular weight of 446.55 g/mol. Its IUPAC name is (2R)-2-[[(2S,3R)-2-[[(2S)-4-amino-2-(nonanoylamino)butanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[[(2S,3R)-2-[[(2S)-4-amino-2-(nonanoylamino)butanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 175901864 |
| Molecular Formula | C20H38N4O7 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2R)-2-[[(2S,3R)-2-[[(2S)-4-amino-2-(nonanoylamino)butanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CCCCCCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@H](CO)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C20H38N4O7/c1-3-4-5-6-7-8-9-16(27)22-14(10-11-21)18(28)24-17(13(2)26)19(29)23-15(12-25)20(30)31/h13-15,17,25-26H,3-12,21H2,1-2H3,(H,22,27)(H,23,29)(H,24,28)(H,30,31)/t13-,14+,15-,17+/m1/s1 |
| InChIKey | QJSXPHRTMKPQJB-DLTWYDFYSA-N |
| XLogP | -1.00 |
| TPSA | 191.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|