C15H31NO5 — CID 71347237
(2S)-2-(dodecanoylamino)-3-hydroxypropanoic acid;hydrate (PubChem CID 71347237) has the molecular formula C15H31NO5 and a molecular weight of 305.41 g/mol. Its IUPAC name is (2S)-2-(dodecanoylamino)-3-hydroxypropanoic acid;hydrate.
| Compound Name | (2S)-2-(dodecanoylamino)-3-hydroxypropanoic acid;hydrate |
|---|---|
| PubChem CID | 71347237 |
| Molecular Formula | C15H31NO5 |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (2S)-2-(dodecanoylamino)-3-hydroxypropanoic acid;hydrate |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](CO)C(=O)O.O |
| InChI | InChI=1S/C15H29NO4.H2O/c1-2-3-4-5-6-7-8-9-10-11-14(18)16-13(12-17)15(19)20;/h13,17H,2-12H2,1H3,(H,16,18)(H,19,20);1H2/t13-;/m0./s1 |
| InChIKey | QSNBPRYUEWIWMC-ZOWNYOTGSA-N |
| XLogP | 1.64 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|