C9H17N3O3 — CID 134235288
(2S)-2-cyclobutyl-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]-2-hydroxyacetamide (PubChem CID 134235288) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is (2S)-2-cyclobutyl-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]-2-hydroxyacetamide.
| Compound Name | (2S)-2-cyclobutyl-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 134235288 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (2S)-2-cyclobutyl-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]-2-hydroxyacetamide |
| SMILES | C[C@H](NC(=O)[C@@H](O)C1CCC1)C(=O)NN |
| InChI | InChI=1S/C9H17N3O3/c1-5(8(14)12-10)11-9(15)7(13)6-3-2-4-6/h5-7,13H,2-4,10H2,1H3,(H,11,15)(H,12,14)/t5-,7-/m0/s1 |
| InChIKey | MQLMNKUYTOHYCF-FSPLSTOPSA-N |
| XLogP | -1.36 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|