C17H36N4O3 — CID 166116113
2-cyclopentyl-N-(1-hydrazinyl-1-oxopropan-2-yl)propanamide;ethane;morpholine (PubChem CID 166116113) has the molecular formula C17H36N4O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-cyclopentyl-N-(1-hydrazinyl-1-oxopropan-2-yl)propanamide;ethane;morpholine.
| Compound Name | 2-cyclopentyl-N-(1-hydrazinyl-1-oxopropan-2-yl)propanamide;ethane;morpholine |
|---|---|
| PubChem CID | 166116113 |
| Molecular Formula | C17H36N4O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | 2-cyclopentyl-N-(1-hydrazinyl-1-oxopropan-2-yl)propanamide;ethane;morpholine |
| SMILES | C1COCCN1.CC.CC(NC(=O)C(C)C1CCCC1)C(=O)NN |
| InChI | InChI=1S/C11H21N3O2.C4H9NO.C2H6/c1-7(9-5-3-4-6-9)10(15)13-8(2)11(16)14-12;1-3-6-4-2-5-1;1-2/h7-9H,3-6,12H2,1-2H3,(H,13,15)(H,14,16);5H,1-4H2;1-2H3 |
| InChIKey | QWDUZOYIOSUMQH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|