tert-butylsilane;hydrazinecarboxylic acid

C5H16N2O2Si — CID 174755643

IUPACtert-butylsilane;hydrazinecarboxylic acid
SMILESCC(C)(C)[SiH3].NNC(=O)O
InChIInChI=1S/C4H12Si.CH4N2O2/c1-4(2,3)5;2-3-1(4)5/h1-3,5H3;3H,2H2,(H,4,5)
InChIKeyAZHVCRLQPGXGKS-UHFFFAOYSA-N
MW164.28 g/mol
LogP-0.30
Rot. Bonds

About tert-butylsilane;hydrazinecarboxylic acid

tert-butylsilane;hydrazinecarboxylic acid (PubChem CID 174755643) has the molecular formula C5H16N2O2Si and a molecular weight of 164.28 g/mol. Its IUPAC name is tert-butylsilane;hydrazinecarboxylic acid.

Molecular Properties

Compound Nametert-butylsilane;hydrazinecarboxylic acid
PubChem CID174755643
Molecular FormulaC5H16N2O2Si
Molecular Weight164.28 g/mol
Exact Mass164.10
IUPAC Nametert-butylsilane;hydrazinecarboxylic acid
SMILESCC(C)(C)[SiH3].NNC(=O)O
InChIInChI=1S/C4H12Si.CH4N2O2/c1-4(2,3)5;2-3-1(4)5/h1-3,5H3;3H,2H2,(H,4,5)
InChIKeyAZHVCRLQPGXGKS-UHFFFAOYSA-N
XLogP-0.30
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.28
LogP ≤ 5-0.30
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze tert-butylsilane;hydrazinecarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butylsilane;hydrazinecarboxylic acid?
The IUPAC name of tert-butylsilane;hydrazinecarboxylic acid (CID 174755643) is tert-butylsilane;hydrazinecarboxylic acid.
What is the SMILES notation for tert-butylsilane;hydrazinecarboxylic acid?
The canonical SMILES for tert-butylsilane;hydrazinecarboxylic acid is CC(C)(C)[SiH3].NNC(=O)O.
What is the InChIKey of tert-butylsilane;hydrazinecarboxylic acid?
The InChIKey is AZHVCRLQPGXGKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12Si.CH4N2O2/c1-4(2,3)5;2-3-1(4)5/h1-3,5H3;3H,2H2,(H,4,5).
What are the key properties of tert-butylsilane;hydrazinecarboxylic acid?
tert-butylsilane;hydrazinecarboxylic acid has a molecular weight of 164.28 g/mol, XLogP of -0.30, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylsilane;hydrazinecarboxylic acid is sourced from PubChem (CID 174755643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).