C6H12N2O — CID 141209160
2,3-dimethylcyclopropane-1-carbohydrazide (PubChem CID 141209160) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 2,3-dimethylcyclopropane-1-carbohydrazide.
| Compound Name | 2,3-dimethylcyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 141209160 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 2,3-dimethylcyclopropane-1-carbohydrazide |
| SMILES | CC1C(C)C1C(=O)NN |
| InChI | InChI=1S/C6H12N2O/c1-3-4(2)5(3)6(9)8-7/h3-5H,7H2,1-2H3,(H,8,9) |
| InChIKey | UICTXRJKVVWRFT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|