C8H13N3O — CID 11205990
(1R,2R,3S,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbohydrazide (PubChem CID 11205990) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbohydrazide.
| Compound Name | (1R,2R,3S,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbohydrazide |
|---|---|
| PubChem CID | 11205990 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (1R,2R,3S,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbohydrazide |
| SMILES | NNC(=O)[C@H]1[C@@H](N)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C8H13N3O/c9-7-5-2-1-4(3-5)6(7)8(12)11-10/h1-2,4-7H,3,9-10H2,(H,11,12)/t4-,5+,6+,7-/m0/s1 |
| InChIKey | HBWMPDZLTHFHPQ-WNJXEPBRSA-N |
| XLogP | -0.87 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|