C6H12N2O — CID 139509215
cis-(1R,2S)-2-methylcyclobutane-1-carbohydrazide (PubChem CID 139509215) has the molecular formula C6H12N2O and a molecular weight of 128.18 g/mol. Its IUPAC name is cis-(1R,2S)-2-methylcyclobutane-1-carbohydrazide.
| Compound Name | cis-(1R,2S)-2-methylcyclobutane-1-carbohydrazide |
|---|---|
| PubChem CID | 139509215 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | cis-(1R,2S)-2-methylcyclobutane-1-carbohydrazide |
| SMILES | C[C@H]1CC[C@H]1C(=O)NN |
| InChI | InChI=1S/C6H12N2O/c1-4-2-3-5(4)6(9)8-7/h4-5H,2-3,7H2,1H3,(H,8,9)/t4-,5+/m0/s1 |
| InChIKey | XRQIPCKCUVTJLQ-CRCLSJGQSA-N |
| XLogP | 0.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|