C7H14N4O2 — CID 130731478
cis-(1S,2R)-cyclopentane-1,2-dicarbohydrazide (PubChem CID 130731478) has the molecular formula C7H14N4O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is cis-(1S,2R)-cyclopentane-1,2-dicarbohydrazide.
| Compound Name | cis-(1S,2R)-cyclopentane-1,2-dicarbohydrazide |
|---|---|
| PubChem CID | 130731478 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | cis-(1S,2R)-cyclopentane-1,2-dicarbohydrazide |
| SMILES | NNC(=O)[C@H]1CCC[C@H]1C(=O)NN |
| InChI | InChI=1S/C7H14N4O2/c8-10-6(12)4-2-1-3-5(4)7(13)11-9/h4-5H,1-3,8-9H2,(H,10,12)(H,11,13)/t4-,5+ |
| InChIKey | GMCCMPWCCUHTKT-SYDPRGILSA-N |
| XLogP | -1.62 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|