C7H14N2O2 — CID 45084499
trans-(1S,2R)-2-(hydroxymethyl)cyclopentane-1-carbohydrazide (PubChem CID 45084499) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is trans-(1S,2R)-2-(hydroxymethyl)cyclopentane-1-carbohydrazide.
| Compound Name | trans-(1S,2R)-2-(hydroxymethyl)cyclopentane-1-carbohydrazide |
|---|---|
| PubChem CID | 45084499 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | trans-(1S,2R)-2-(hydroxymethyl)cyclopentane-1-carbohydrazide |
| SMILES | NNC(=O)[C@H]1CCC[C@H]1CO |
| InChI | InChI=1S/C7H14N2O2/c8-9-7(11)6-3-1-2-5(6)4-10/h5-6,10H,1-4,8H2,(H,9,11)/t5-,6-/m0/s1 |
| InChIKey | VAPPPUPPBGBKGI-WDSKDSINSA-N |
| XLogP | -0.62 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|