C7H15N3O — CID 127009267
1-amino-3-(2,3-dimethylcyclobutyl)urea (PubChem CID 127009267) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is 1-amino-3-(2,3-dimethylcyclobutyl)urea.
| Compound Name | 1-amino-3-(2,3-dimethylcyclobutyl)urea |
|---|---|
| PubChem CID | 127009267 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 1-amino-3-(2,3-dimethylcyclobutyl)urea |
| SMILES | CC1CC(NC(=O)NN)C1C |
| InChI | InChI=1S/C7H15N3O/c1-4-3-6(5(4)2)9-7(11)10-8/h4-6H,3,8H2,1-2H3,(H2,9,10,11) |
| InChIKey | UOSWUUIRXHMELZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|