C10H20N2O — CID 131113753
1-(2,3-dimethylcyclobutyl)-3-propan-2-ylurea (PubChem CID 131113753) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclobutyl)-3-propan-2-ylurea.
| Compound Name | 1-(2,3-dimethylcyclobutyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 131113753 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-(2,3-dimethylcyclobutyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC1CC(C)C1C |
| InChI | InChI=1S/C10H20N2O/c1-6(2)11-10(13)12-9-5-7(3)8(9)4/h6-9H,5H2,1-4H3,(H2,11,12,13) |
| InChIKey | QUHANXHPVPDZDD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |