C10H17N — CID 155306452
N-buta-1,3-dien-2-yl-2,3-dimethylcyclobutan-1-amine (PubChem CID 155306452) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-2,3-dimethylcyclobutan-1-amine.
| Compound Name | N-buta-1,3-dien-2-yl-2,3-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 155306452 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-buta-1,3-dien-2-yl-2,3-dimethylcyclobutan-1-amine |
| SMILES | C=CC(=C)NC1CC(C)C1C |
| InChI | InChI=1S/C10H17N/c1-5-8(3)11-10-6-7(2)9(10)4/h5,7,9-11H,1,3,6H2,2,4H3 |
| InChIKey | LULFZCUTYACTPK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|