About N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine
N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine (PubChem CID 163712422) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine.
Analyze N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine?
The IUPAC name of N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine (CID 163712422) is N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine.
What is the SMILES notation for N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine?
The canonical SMILES for N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine is C=C=C=CNC1CC1C.
What is the InChIKey of N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine?
The InChIKey is KKKPPYXHWCNTMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-3-4-5-9-8-6-7(8)2/h5,7-9H,1,6H2,2H3.
What are the key properties of N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine?
N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine has a molecular weight of 121.18 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-1,2,3-trienyl-2-methylcyclopropan-1-amine is sourced from PubChem (CID 163712422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).