C10H16N2O — CID 157408507
N-[3-(buta-1,3-dien-2-ylamino)cyclobutyl]acetamide (PubChem CID 157408507) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[3-(buta-1,3-dien-2-ylamino)cyclobutyl]acetamide.
| Compound Name | N-[3-(buta-1,3-dien-2-ylamino)cyclobutyl]acetamide |
|---|---|
| PubChem CID | 157408507 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-[3-(buta-1,3-dien-2-ylamino)cyclobutyl]acetamide |
| SMILES | C=CC(=C)NC1CC(NC(C)=O)C1 |
| InChI | InChI=1S/C10H16N2O/c1-4-7(2)11-9-5-10(6-9)12-8(3)13/h4,9-11H,1-2,5-6H2,3H3,(H,12,13) |
| InChIKey | BNZURSDGZZKPLL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|