C7H16OS4 — CID 174664994
carbonodithioic S,S-acid;2-(propan-2-yldisulfanyl)propane (PubChem CID 174664994) has the molecular formula C7H16OS4 and a molecular weight of 244.47 g/mol. Its IUPAC name is carbonodithioic S,S-acid;2-(propan-2-yldisulfanyl)propane.
| Compound Name | carbonodithioic S,S-acid;2-(propan-2-yldisulfanyl)propane |
|---|---|
| PubChem CID | 174664994 |
| Molecular Formula | C7H16OS4 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | carbonodithioic S,S-acid;2-(propan-2-yldisulfanyl)propane |
| SMILES | CC(C)SSC(C)C.O=C(S)S |
| InChI | InChI=1S/C6H14S2.CH2OS2/c1-5(2)7-8-6(3)4;2-1(3)4/h5-6H,1-4H3;(H2,2,3,4) |
| InChIKey | HMOKKRCSKIRWBT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|