About carbonodithioic S,S-acid;neodymium
carbonodithioic S,S-acid;neodymium (PubChem CID 87149190) has the molecular formula CH2NdOS2
and a molecular weight of 238.40 g/mol. Its IUPAC name is carbonodithioic S,S-acid;neodymium.
Molecular Properties
| Compound Name | carbonodithioic S,S-acid;neodymium |
| PubChem CID | 87149190 |
| Molecular Formula | CH2NdOS2 |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 235.86 |
| IUPAC Name | carbonodithioic S,S-acid;neodymium |
| SMILES | O=C(S)S.[Nd] |
| InChI | InChI=1S/CH2OS2.Nd/c2-1(3)4;/h(H2,2,3,4); |
| InChIKey | CUVAWIWXSOMLCM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbonodithioic S,S-acid;neodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonodithioic S,S-acid;neodymium?
The IUPAC name of carbonodithioic S,S-acid;neodymium (CID 87149190) is carbonodithioic S,S-acid;neodymium.
What is the SMILES notation for carbonodithioic S,S-acid;neodymium?
The canonical SMILES for carbonodithioic S,S-acid;neodymium is O=C(S)S.[Nd].
What is the InChIKey of carbonodithioic S,S-acid;neodymium?
The InChIKey is CUVAWIWXSOMLCM-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2OS2.Nd/c2-1(3)4;/h(H2,2,3,4);.
What are the key properties of carbonodithioic S,S-acid;neodymium?
carbonodithioic S,S-acid;neodymium has a molecular weight of 238.40 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonodithioic S,S-acid;neodymium is sourced from PubChem (CID 87149190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).