About azane;carbamothioic S-acid
azane;carbamothioic S-acid (PubChem CID 12743068) has the molecular formula CH6N2OS
and a molecular weight of 94.14 g/mol. Its IUPAC name is azane;carbamothioic S-acid.
Molecular Properties
| Compound Name | azane;carbamothioic S-acid |
| PubChem CID | 12743068 |
| Molecular Formula | CH6N2OS |
| Molecular Weight | 94.14 g/mol |
| Exact Mass | 94.02 |
| IUPAC Name | azane;carbamothioic S-acid |
| SMILES | N.NC(=O)S |
| InChI | InChI=1S/CH3NOS.H3N/c2-1(3)4;/h(H3,2,3,4);1H3 |
| InChIKey | PTYONPWKVPLXDZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.14 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;carbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;carbamothioic S-acid?
The IUPAC name of azane;carbamothioic S-acid (CID 12743068) is azane;carbamothioic S-acid.
What is the SMILES notation for azane;carbamothioic S-acid?
The canonical SMILES for azane;carbamothioic S-acid is N.NC(=O)S.
What is the InChIKey of azane;carbamothioic S-acid?
The InChIKey is PTYONPWKVPLXDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NOS.H3N/c2-1(3)4;/h(H3,2,3,4);1H3.
What are the key properties of azane;carbamothioic S-acid?
azane;carbamothioic S-acid has a molecular weight of 94.14 g/mol, XLogP of 0.16, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;carbamothioic S-acid is sourced from PubChem (CID 12743068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).