About CID 87646890
CID 87646890 (PubChem CID 87646890) has the molecular formula CH3NOPbS
and a molecular weight of 284.31 g/mol.
Molecular Properties
| Compound Name | CID 87646890 |
| PubChem CID | 87646890 |
| Molecular Formula | CH3NOPbS |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | — |
| SMILES | NC(=O)S.[Pb] |
| InChI | InChI=1S/CH3NOS.Pb/c2-1(3)4;/h(H3,2,3,4); |
| InChIKey | DLPWAISVQJTHIO-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 87646890 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87646890?
The IUPAC name of CID 87646890 (CID 87646890) is not available.
What is the SMILES notation for CID 87646890?
The canonical SMILES for CID 87646890 is NC(=O)S.[Pb].
What is the InChIKey of CID 87646890?
The InChIKey is DLPWAISVQJTHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NOS.Pb/c2-1(3)4;/h(H3,2,3,4);.
What are the key properties of CID 87646890?
CID 87646890 has a molecular weight of 284.31 g/mol, XLogP of -0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87646890 is sourced from PubChem (CID 87646890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).