C6H14N4O2 — CID 51037640
2-amino-3,4,4,5,5-pentadeuterio-5-(diaminomethylideneamino)(413C)pentanoic acid (PubChem CID 51037640) has the molecular formula C6H14N4O2 and a molecular weight of 180.23 g/mol. Its IUPAC name is 2-amino-3,4,4,5,5-pentadeuterio-5-(diaminomethylideneamino)(413C)pentanoic acid.
| Compound Name | 2-amino-3,4,4,5,5-pentadeuterio-5-(diaminomethylideneamino)(413C)pentanoic acid |
|---|---|
| PubChem CID | 51037640 |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2-amino-3,4,4,5,5-pentadeuterio-5-(diaminomethylideneamino)(413C)pentanoic acid |
| SMILES | [2H]C(C(N)C(=O)O)[13C]([2H])([2H])C([2H])([2H])N=C(N)N |
| InChI | InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/i1+1D2,2D,3D2 |
| InChIKey | ODKSFYDXXFIFQN-KKJBBIHOSA-N |
| XLogP | -1.55 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|