C6H14N4O2 — CID 117064614
(2S)-2-amino-4,4,5,5-tetradeuterio-5-(diaminomethylideneamino)(513C)pentanoic acid (PubChem CID 117064614) has the molecular formula C6H14N4O2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (2S)-2-amino-4,4,5,5-tetradeuterio-5-(diaminomethylideneamino)(513C)pentanoic acid.
| Compound Name | (2S)-2-amino-4,4,5,5-tetradeuterio-5-(diaminomethylideneamino)(513C)pentanoic acid |
|---|---|
| PubChem CID | 117064614 |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (2S)-2-amino-4,4,5,5-tetradeuterio-5-(diaminomethylideneamino)(513C)pentanoic acid |
| SMILES | [2H]C([2H])(C[C@H](N)C(=O)O)[13C]([2H])([2H])N=C(N)N |
| InChI | InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1/i1D2,3+1D2 |
| InChIKey | ODKSFYDXXFIFQN-BRCPYFOBSA-N |
| XLogP | -1.55 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|